Ksiluloz

Vikipedi, özgür ansiklopedi
Atla: kullan, ara
Ksiluloz[1][2]
Xylulose.png
Kimyasal adı (3R,4S)-1,3,4,5-Tetrahydroxypentan-2-one
Diğer adları Treo-Pentuloz

Treo-2-Pentuloz

Kimyasal formül C5H10O5
Molekül ağırlığı 150.13 g/mol
CAS numarası 527-50-4
Ergime noktası °C
Kaynama noktası °C
SMILES C([C@@H]([C@H](C(=O)CO)O)O)O
Kaynakça ve sorumluluk reddi

Ksiluloz, beş karbonlu bir monosakkarittir. Beş karbona ek olarak bir keton grubu barındırdığından ötürü, ksiluloz bir ketopentozdur. Kimyasal formülü C5H10O5 şeklindedir. Doğada ksilulozun L- ve D-enantiyomerleri mevcuttur.

Patoloji[değiştir | kaynağı değiştir]

L-Ksiluloz, L-ksiluloz redüktazındaki eksiklikten kaynaklanan pentozüri hastalarında idrarda birikir. L-ksilulozun, D-glukoz gibi bir azalan şeker olması dolayısıyla, pentozüri hastaları yanlış bir biçimde geçmişte şeker hastası olarak teşhis edilmiştir.

Ayrıca bakınız[değiştir | kaynağı değiştir]

Kaynakça[değiştir | kaynağı değiştir]

  1. ^ Data is for L-xylulose.
  2. ^ Merck Index, 11th Edition, 9996.

Dış bağlantılar[değiştir | kaynağı değiştir]